سكوالين

سكوالين
الأسماء
	اسم أيوپاك النظامي (6E,10E,14E,18E)-2,6,10,15,19,23-Hexamethyltetracosa-2,6,10,14,18,22-hexaene
المُعرِّفات
رقم CAS
3D model (JSmol)	Interactive image;
3DMet	B00166;
مرجع بايلستاين	1728919
ChEBI	CHEBI:15440 ;
ChEMBL	ChEMBL458402 ;
ChemSpider	553635 ;
ECHA InfoCard	100.003.479
رقم EC	203-826-1;
KEGG	C00751 ;
عناوين مواضيع طبية MeSH	{{{value}}}
PubChem CID	638072;
رقم RTECS	XB6010000;
UNII	7QWM220FJH ;
CompTox Dashboard (EPA)	DTXSID0026044 ;
	InChI InChI=1S/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3/b27-17+,28-18+,29-23+,30-24+ Key: YYGNTYWPHWGJRM-AAJYLUCBSA-N ; InChI=1/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3;
	SMILES CC(=CCC/C(=C/CC/C(=C/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)/C)/C)C;
الخصائص
الصيغة الجزيئية	C30H50
كتلة مولية	410.72 g mol-1
المظهر	Pale yellow, translucent liquid
الكثافة	0.858 g cm-3
نقطة الانصهار
نقطة الغليان
log P	12.188
اللزوجة	12 cP (at 20 °C)
المخاطر
نقطة الوميض	110 °C (230 °F; 383 K)
	ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
	verify (what is ?)
	مراجع الجدول

سكوالين Squalene هو مركب ذو كثافة قليلة (كثافة نوعية ~ 0.86) يوجد في الأسماك الغضروفية مثل القرش، التى تفتقد إلى مثانة سباحة وبالتالى يجب عليها أن تعوض ذلك بتقليل كثافة أجسامها بالدهون والزيوت. ويساعد السكواين أيضا في ذلك. ويتم حفظ السكوالين بصفة عامة في الكبد (ولذلك يسمى "زيت كبد القرش"). كما يتواجد السكوالين أيضا بكميات قليلة في جسم الإنسان، عند تحول الكوليستيرول إلى دهون. وهو الإسم العلمي لزيت الأنف.

السكوالين هي مواد هيدروكربونية توجد في اكباد الكواسج تجعل وزن السمكه الثقيل قابل للعوم. وحديثا يتم اصطياد سمك القرش بكثرة لاستخراج السكوالين منه، لعمل كبسولات السكوالين التى تساعد على تستخدم كموقيات. وعموما فإنه لازالت الأبحاث جارية ويعتقد أن السكوالين ليس له هذا التأثير الذى يفترض وجوده.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

الدور في تخليق السترويد

في الحيوانات، فإن السكوالين هو السابق البيوكيميائي لكل أسرة الستيرويدات.^[2] Oxidation (via squalene monooxygenase) of one of the terminal double bonds of squalene yields 2,3-squalene oxide, which undergoes enzyme-catalyzed cyclization to afford lanosterol, which is then elaborated into cholesterol and other steroids.

Simplified version of the steroid synthesis pathway with the intermediates isopentenyl pyrophosphate (IPP), dimethylallyl pyrophosphate (DMAPP), geranyl pyrophosphate (GPP) and squalene shown. Some intermediates are omitted.

Squalene is an ancient molecule. In plants, squalene is the precursor to stigmasterol. In certain fungi, it is the precursor to ergosterol. However, blue-green algae and some bacteria do not manufacture squalene, and must acquire it from the environment if they need it.

التخليق الحيوي

Two molecules of farnesyl pyrophosphate condense with reduction by NADPH to form squalene - by squalene synthase.

خريطة تفاعلية للسبيل

Click on genes, proteins and metabolites below to link to respective articles. ^{[§ 1]}

[[File:

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

[[

]]

|alt=Statin Pathway edit]]

Statin Pathway edit

^ The interactive pathway map can be edited at WikiPathways: "Statin_Pathway_WP430".

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

سكوالين سمك القرش

Shark liver oil Capsule.

الهامش

^ CID 1105 من PubChem
^ Bloch, Konrad E. (1983). "Sterol, Structure and Membrane Functio". Critical Reviews in Biochemistry and Molecular Biology. 14: 47–92. doi:10.3109/10409238309102790.

قالب:Cholesterol metabolism intermediates

[WikiPathways-3] The interactive pathway map can be edited at WikiPathways: "Statin_Pathway_WP430".

[1] CID 1105 من PubChem

[2] Bloch, Konrad E. (1983). "Sterol, Structure and Membrane Functio". Critical Reviews in Biochemistry and Molecular Biology. 14: 47–92. doi:10.3109/10409238309102790.

[1]

[2]

[§ 1]