خلات الليثيوم

خلات الليثيوم

الأسماء
اسم أيوپاك المفضل Lithium acetate
المُعرِّفات
رقم CAS
3D model (JSmol)	Interactive image
ChEBI	CHEBI:CHEBI:63045 N
ChemSpider	10562 N
ECHA InfoCard	100.008.105
رقم EC	208-914-3
KEGG	D08134 N
عناوين مواضيع طبية MeSH	{{{value}}}
PubChem CID	11028
رقم RTECS	AI545000
UNII	H4278O5FLV Y
CompTox Dashboard (EPA)	DTXSID00883436
InChI InChI=1S/C2H4O2.Li/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 N Key: XIXADJRWDQXREU-UHFFFAOYSA-M N InChI=1/C2H4O2.Li/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 Key: XIXADJRWDQXREU-REWHXWOFAX
SMILES [Li+].CC(=O)[O-]
الخصائص
الصيغة الجزيئية	C2H3LiO2
كتلة مولية	65.97 g mol-1
المظهر	crystal
الكثافة	1.26 g/cm3
نقطة الانصهار
قابلية الذوبان في الماء	45.0 g/100 mL
القابلية المغناطيسية	−34.0·10−6 cm3/mol
المخاطر
خطر رئيسي	toxic
صفحة بيانات السلامة	External MSDS
NFPA 704 (معيـَّن النار)	0 2 0
الجرعة أو التركيز القاتل (LD, LC):
LD50 (الجرعة الوسطى)	500 mg/kg (oral, mouse)
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
N verify (what is YN ?)
مراجع الجدول

خلات ليثيوم مركب كيميائي له الصيغة CH₃COOLi ، وهو ملح الليثيوم لحمض الخل.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

 الاستخدامات

Lithium acetate is used in the laboratory as buffer for gel electrophoresis of DNA and RNA. It has a lower electrical conductivity and can be run at higher speeds than can gels made from TAE buffer (5-30V/cm as compared to 5-10V/cm). At a given voltage, the heat generation and thus the gel temperature is much lower than with TAE buffers, therefore the voltage can be increased to speed up electrophoresis so that a gel run takes only a fraction of the usual time. Downstream applications, such as isolation of DNA from a gel slice or Southern blot analysis, work as expected when using lithium acetate gels.

Lithium boric acid or sodium boric acid are usually preferable to lithium acetate or TAE when analyzing smaller fragments of DNA (less than 500 bp) due to the higher resolution of borate-based buffers in this size range as compared to acetate buffers.

Lithium acetate is also used to permeabilize the cell wall of yeast for use in DNA transformation. It is believed that the beneficial effect of LiOAc is caused by its chaotropic effect; denaturing DNA, RNA and proteins.

 المصادر

أملاح وإستر أيون الخلات
AcOH																	He
LiOAc	Be(OAc)2 BeAcOH											B(OAc)3	ROAc	NH4OAc	AcOAc	FAc	Ne
NaOAc	Mg(OAc)2											Al(OAc)3 ALSOL Al(OAc)2OH	Si	P	S	ClAc	Ar
KOAc	Ca(OAc)2	Sc(OAc)3	Ti(OAc)4	VO(OAc)3	Cr(OAc)2	Mn(OAc)2 MnAc3	Fe(OAc)2 FeAc3	Co(OAc)2, CoAc3	Ni(OAc)2	Cu(OAc)2	Zn(OAc)2	Ga(OAc)3	Ge	As	Se	BrAc	Kr
RbOAc	Sr(OAc)2	Y(OAc)3	Zr(OAc)4	Nb	Mo(OAc)2	Tc	Ru	Rh	Pd(OAc)2	AgOAc	Cd(OAc)2	In	Sn(OAc)2 SnAc4	Sb(OAc)3	Te	IAc	Xe
CsOAc	Ba(OAc)2		Hf	Ta	W	Re	Os	Ir	Pt(OAc)2	Au	Hg2(OAc)2, HgAc2	TlOAc Tl(OAc)3	Pb(OAc)2 Pb(OAc)4	Bi(OAc)3	Po	At	Rn
Fr	Ra		Rf	Db	Sg	Bh	Hs	Mt	Ds	Rg	Cn	Uut	Fl	Uup	Lv	Uus	Uuo
		↓
		La(OAc)3	Ce(OAc)x	Pr	Nd	Pm	Sm(OAc)3	Eu(OAc)3	Gd(OAc)3	Tb	Dy(OAc)3	Ho(OAc)3	Er	Tm	Yb(OAc)3	Lu(OAc)3
		Ac	Th	Pa	UO2(OAc)2	Np	Pu	Am	Cm	Bk	Cf	Es	Fm	Md	No	Lr