حمض دهني
أنواع الدهون في الغذاء |
---|
انظر أيضاً |
الأحماض الدهنية Fatty Acids هي مادة دهنية ذات سعرات حرارية مرتفعة مكونة من سلسلة كربون محاطة بالهايدروجين. وسبب وصف هذه الدهون بالحمضية أن أحد طرفي السلسلة الكربونية ينتهي بالجزء الحمضي COOH. بينما ينتهي الطرف الآخر بذرة كربون متصلة بثلاث ذرات هيدروجين
وتختلف أنواع الدهون وتسمياتها طبقاً لعاملين:
- عدد ذرات الكربون في السلسلة
- توزيع ذرات الهادروجين على ذرات الكربون (وبالتالي نوعية الروابط التي تربط ذرات الكربون)
. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
أنواع الأحماض الدهنية
ويقسم العلماء الأحماض الدهنية إلى نوعين أساسيين:
- أحماض دهنية مشبعة
- أحماض دهنية غير مشبعة (تنقسم بدورها إلى ثلاثة انواع هامة)
الأحماض الدهنية المشبعة
Most commonly occurring saturated fatty acids are:
Butyric | (butanoic acid): | CH3(CH2)2COOH | C4:0 |
Caproic | (hexanoic acid): | CH3(CH2)4COOH | C6:0 |
Caprylic | (octanoic acid): | CH3(CH2)6COOH | C8:0 |
Capric | (decanoic acid): | CH3(CH2)8COOH | C10:0 |
Lauric | (dodecanoic acid): | CH3(CH2)10COOH | C12:0 |
Myristic | (tetradecanoic acid): | CH3(CH2)12COOH | C14:0 |
Palmitic | (hexadecanoic acid): | CH3(CH2)14COOH | C16:0 |
Stearic | (octadecanoic acid): | CH3(CH2)16COOH | C18:0 |
Arachidic | (eicosanoic acid): | CH3(CH2)18COOH | C20:0 |
Behenic | (docosanoic acid): | CH3(CH2)20COOH | C22:0 |
الأحماض الدهنية اللا مشبعة
- cis
- A cis configuration means that adjacent carbon atoms are on the same side of the double bond.
- trans
- A trans configuration, by contrast, means that the next two carbon atoms are bound to opposite sides of the double bond. As a result, they don't cause the chain to bend much, and their shape is similar to straight saturated fatty acids.
نظام التسمية
هناك طريقتان to make clear where the double bonds are located in molecules. For example:
- cis/trans-Delta-x or cis/trans-Δx:
- Omega-x or ω-x : A double bond is located on the xth carbon-carbon bond, counting from the ω, (methyl carbon) end of the chain. Sometimes, the symbol ω is substituted with a lowercase letter n, making it n-6 or n-3.
أمثلة للأحماض الدهنية غير المشبعة:
Myristoleic acid: | CH3(CH2)3CH=CH(CH2)7COOH | C14:1 |
Palmitoleic acid: | CH3(CH2)5CH=CH(CH2)7COOH | C16:1 |
Oleic acid: | CH3(CH2)7CH=CH(CH2)7COOH or cis-Δ9 | C18:1 |
Linoleic acid: | CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH | C18:2 |
Alpha-linolenic acid: | CH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH | C18:3 |
Arachidonic acid | CH3(CH2)4CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2)3COOHNIST | C20:4 |
Eicosapentaenoic acid | C20:5 | |
Erucic acid: | CH3(CH2)7CH=CH(CH2)11COOH | C22:1 |
Docosahexaenoic acid | C22:6 |
الأحماض الدهنية الأساسية
- مقالة مفصلة: حمض دهني أساسي
أحماض دهنية متحورة
- مقالة مفصلة: دهن متحور
Free fatty acids
Fatty acids can be bound or attached to other molecules, such as in triglycerides or phospholipids. When they are not attached to other molecules, they are known as "free" fatty acids.
الأحماض الدهنية في الدهون الغذائية
The following table gives the fatty acid and cholesterol composition of some common dietary fats.[1] [2]
مشبع | أحادي عدم التشبع | متعدد عدم التشبع | Cholesterol | Vitamin E | |
---|---|---|---|---|---|
g/100g | g/100g | g/100g | mg/100g | mg/100g | |
الدهون الحيوانية | |||||
شحم الخنزير | 40.8 | 43.8 | 9.6 | 93 | 0.00 |
زبدة | 54.0 | 19.8 | 2.6 | 230 | 2.00 |
الدهون النباتية | |||||
زيت جوز الهند | 85.2 | 6.6 | 1.7 | 0 | .66 |
زيت النخيل | 45.3 | 41.6 | 8.3 | 0 | 33.12 |
زيت بذرة القطن | 25.5 | 21.3 | 48.1 | 0 | 42.77 |
Wheat germ oil | 18.8 | 15.9 | 60.7 | 0 | 136.65 |
زيت الصويا | 14.5 | 23.2 | 56.5 | 0 | 16.29 |
زيت الزيتون | 14.0 | 69.7 | 11.2 | 0 | 5.10 |
زيت الذرة | 12.7 | 24.7 | 57.8 | 0 | 17.24 |
Sunflower oil | 11.9 | 20.2 | 63.0 | 0 | 49.0 |
Safflower oil | 10.2 | 12.6 | 72.1 | 0 | 40.68 |
Rapeseed/Canola oil | 5.3 | 64.3 | 24.8 | 0 | 22.21 |
الحامضية
المصادر
- ^ Food Standards Agency (1991). "Fats and Oils". McCance & Widdowson's The Composition of Foods. Royal Society of Chemistry.
- ^ Ted Altar. "More Than You Wanted To Know About Fats/Oils". Sundance Natural Foods Online. Retrieved 2006-08-31.
. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
انظر أيضاً
- Essential fatty acid
- Triglyceride
- دهن مشبع
- دهن غير مشبع
- Fatty acid synthase
- Fatty acid metabolism
- زيوت نباتية
وصلات خارجية
- Chemical Structure of Fats and Fatty Acids
- Plant Oils and Fats, from the Cyberlipid Center Web site
- "Fat content and fatty acid composition of seed oils". Retrieved 2006-10-07. From Udo Erasmus' book, Fats that Heal Fats that Kill
قائمة العائلات الكيميائية الحيوية | |
---|---|
النشويات | |
الدهون | |
الأحماض الأمينية | |
الپروتينات | |
أخرى |