كربونات الروبيديوم

كربونات الروبيديوم
الأسماء
	اسم أيوپاك Rubidium carbonate
المُعرِّفات
رقم CAS
3D model (JSmol)	Interactive image;
ChemSpider	10950 ;
ECHA InfoCard	100.008.666
PubChem CID	11431;
رقم RTECS	FG0650000;
CompTox Dashboard (EPA)	DTXSID50889428 ;
	InChI InChI=1S/CH2O3.2Rb/c2-1(3)4;;/h(H2,2,3,4);;/q;2+1/p-2 Key: WPFGFHJALYCVMO-UHFFFAOYSA-L ; InChI=1/CH2O3.2Rb/c2-1(3)4;;/h(H2,2,3,4);;/q;2+1/p-2 Key: WPFGFHJALYCVMO-NUQVWONBAM;
	SMILES [Rb+].[Rb+].[O-]C([O-])=O;
الخصائص
الصيغة الجزيئية	Rb2CO3
كتلة مولية	230.945 g/mol
المظهر	White powder, ; very hygroscopic
نقطة الانصهار
نقطة الغليان
قابلية الذوبان في الماء	Very soluble
القابلية المغناطيسية	−75.4·10−6 cm3/mol
المخاطر
خطر رئيسي	Irritant
نقطة الوميض	Non-flammable
مركبات ذا علاقة
كاتيونات أخرى	Lithium carbonate; Sodium carbonate; Potassium carbonate; Caesium carbonate
	ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
	verify (what is ?)
	مراجع الجدول

Rubidium carbonate, Rb₂CO₃, is a convenient compound of rubidium; it is stable, not particularly reactive, and readily soluble in water, and is the form in which rubidium is usually sold.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

Preparation

This salt can be prepared by adding ammonium carbonate to rubidium hydroxide.^[1]

Uses

It is used in some kinds of glass-making by enhancing stability and durability as well as reducing its conductivity. It is also used as a part of a catalyst for preparing short-chain alcohols from feed gas.^[2]

References

^ Chisholm, Hugh, ed. (1911). "Rubidium" . دائرة المعارف البريطانية. Vol. 23 (eleventh ed.). Cambridge University Press. p. 809. {{cite encyclopedia}}: Cite has empty unknown parameter: |coauthors= (help)
^ Canada Patents