حمض الأوروتيك

حمض الأوروتيك

البيانات السريرية
AHFS/Drugs.com	International Drug Names
رمز ATC	none
المعرفات
IUPAC name 1,2,3,6-Tetrahydro-2,6-dioxo-4-pyrimidinecarboxylic acid
رقم CAS	65-86-1 Y
PubChem CID	967
IUPHAR/BPS	4690
DrugBank	DB02262 N
ChemSpider	942 N
UNII	61H4T033E5
KEGG	C00295 N
CompTox Dashboard (EPA)	DTXSID0025814
ECHA InfoCard	100.000.563
Chemical and physical data
التركيب	C5H4N2O4
الكتلة المولية	156.10 g/mol
3D model (JSmol)	Interactive image
SMILES O=C(O)\C1=C\C(=O)NC(=O)N1
InChI InChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11) N Key:PXQPEWDEAKTCGB-UHFFFAOYSA-N N
NY (what is this?)  (verify)

حمض الأوروتيك Orotic acid هو heterocyclic compound و حمض؛ it is also known as pyrimidinecarboxylic acid. تاريخياً كان يُعتقد أنه جزء من مجمع ڤيتامين ب وكان يسمى ڤيتامين ب₁₃، إلا أننا الآن نعرف أنه ليس ڤيتامين.

The compound is manufactured in the body via a mitochondrial enzyme, dihydroorotate dehydrogenase. or a cytoplasmic enzyme of pyrimidine synthesis pathway. It is sometimes used as a mineral carrier in some dietary supplements (to increase their bioavailability), most commonly for lithium orotate.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

 التخليق

Dihydroorotate is synthesized to orotic acid by the enzyme dihydroorotate dehydrogenase, where it later combines with phosphoribosyl pyrophosphate (PRPP) to form orotidine-5'-monophosphate (OMP). A distinguishing characteristic of pyrimidine synthesis is that the pyrimidine ring is fully synthesized before being attached to the ribose sugar, whereas purine synthesis happens by building the base directly on the sugar.

 السلامة

Orotic acid can be mutagenic in mammalian somatic cells. It is also mutagenic for bacteria and yeast.

 الأمراض

A buildup of orotic acid can lead to orotic aciduria and acidemia. It may be a symptom of an increased ammonia load due to a metabolic disorder, such as a urea cycle disorder.

In ornithine transcarbamoylase deficiency, an X-linked inherited and the most common urea cycle disorder, excess carbamoyl phosphate is converted into orotic acid. This leads to an increased serum ammonia level, increased serum and urinary orotic acid levels and a decreased serum blood urea nitrogen level. This also leads to an increased urinary orotic acid excretion, because the orotic acid is not being properly utilized and must be eliminated. The hyperammonemia depletes alpha-ketoglutarate leading to the inhibition of the tricarboxylic acid cycle (TCA) decreasing adenosine triphosphate (ATP) production.

Orotic aciduria is a cause of megaloblastic anaemia.

 انظر أيضاً

• أوروتات المغنسيوم
• التخليق الحيوي للپيريميدين Pyrimidine biosynthesis

 وصلات خارجية

• MeSH Orotic+Acid
• Greenbaum, Sheldon B. (1954). "Potential Metabolic Antagonists of Orotic Acid: 6-Uracilsulfonamide and 6-Uracil Methyl Sulfone1". Journal of the American Chemical Society. 76 (23): 6052–6054. doi:10.1021/ja01652a056.