ملف:3-(3,4-dihydroxyphenyl)lactic acid.svg
حجم معاينة PNG لذلك الملف ذي الامتداد SVG: 181 × 75 بكسل. البعد الآخر: 2٬560 × 1٬061 بكسل.
الملف الأصلي (ملف SVG، أبعاده 181 × 75 بكسل، حجم الملف: 12 كيلوبايت)
وصف قصير
| ⧼wm-license-information-description⧽ |
English: 3-(3,4-dihydroxyphenyl)lactic acid or salvianic acid A. Created using BKChem, based on SMILES C(C(C(=O)O)O)c1ccc(O)c(O)c1, modified to C(C(C(=O)OH)OH)c1ccc(OH)c(OH)c1 in order to show hydroxy groups and cropped with Inkscape (Control-Shift-D). Chinese pharmacological literature calls this compound Danshensu
|
|
| ⧼wm-license-information-date⧽ | 2012 | |
| ⧼wm-license-information-source⧽ | ⧼Wm-license-own-work⧽ | |
| ⧼wm-license-information-author⧽ | Albmont | |
| ⧼wm-license-information-permission⧽ (⧼wm-license-information-permission-reusing-text⧽) |
|
تاريخ الملف
اضغط على زمن/تاريخ لرؤية الملف كما بدا في هذا الزمن.
| زمن/تاريخ | صورة مصغرة | الأبعاد | مستخدم | تعليق | |
|---|---|---|---|---|---|
| حالي | ★ مراجعة معتمدة 06:08، 15 يناير 2024 | | 181 × 75 (12 كيلوبايت) | Pastakhov (نقاش | مساهمات) | Upload https://upload.wikimedia.org/wikipedia/commons/5/56/3-%283%2C4-dihydroxyphenyl%29lactic_acid.svg |
لا يمكنك استبدال هذا الملف.
وصلات
لا يوجد صفحات تصل لهذه الصورة.
lactic_acid.svg&oldid=3876245){kind=link}